C13H18Cl2N2O4 — CID 119912902
2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride (PubChem CID 119912902) has the molecular formula C13H18Cl2N2O4 and a molecular weight of 337.20 g/mol. Its IUPAC name is 2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119912902 |
| Molecular Formula | C13H18Cl2N2O4 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
| SMILES | COc1ccc(NC(=O)CN(C)C(C)C(=O)O)cc1Cl.Cl |
| InChI | InChI=1S/C13H17ClN2O4.ClH/c1-8(13(18)19)16(2)7-12(17)15-9-4-5-11(20-3)10(14)6-9;/h4-6,8H,7H2,1-3H3,(H,15,17)(H,18,19);1H |
| InChIKey | VXBHQTGRRBYNKG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |