C12H15ClN2O4 — CID 83194842
(2R)-2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]propanoic acid (PubChem CID 83194842) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.72 g/mol. Its IUPAC name is (2R)-2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 83194842 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2R)-2-[[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]amino]propanoic acid |
| SMILES | COc1ccc(NC(=O)CN[C@H](C)C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O4/c1-7(12(17)18)14-6-11(16)15-8-3-4-10(19-2)9(13)5-8/h3-5,7,14H,6H2,1-2H3,(H,15,16)(H,17,18)/t7-/m1/s1 |
| InChIKey | DNDAJHNRJOOLPD-SSDOTTSWSA-N |
| XLogP | 1.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |