C14H21ClN2O4S — CID 113148752
2-[butan-2-yl(methylsulfonyl)amino]-N-(3-chloro-4-methoxyphenyl)acetamide (PubChem CID 113148752) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is 2-[butan-2-yl(methylsulfonyl)amino]-N-(3-chloro-4-methoxyphenyl)acetamide.
| Compound Name | 2-[butan-2-yl(methylsulfonyl)amino]-N-(3-chloro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113148752 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-[butan-2-yl(methylsulfonyl)amino]-N-(3-chloro-4-methoxyphenyl)acetamide |
| SMILES | CCC(C)N(CC(=O)Nc1ccc(OC)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C14H21ClN2O4S/c1-5-10(2)17(22(4,19)20)9-14(18)16-11-6-7-13(21-3)12(15)8-11/h6-8,10H,5,9H2,1-4H3,(H,16,18) |
| InChIKey | QQOCQUNQRSBGHF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |