C12H16ClFN2O3 — CID 119913197
2-[[2-(2-fluoroanilino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride (PubChem CID 119913197) has the molecular formula C12H16ClFN2O3 and a molecular weight of 290.72 g/mol. Its IUPAC name is 2-[[2-(2-fluoroanilino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[[2-(2-fluoroanilino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913197 |
| Molecular Formula | C12H16ClFN2O3 |
| Molecular Weight | 290.72 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-[[2-(2-fluoroanilino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CC(=O)Nc1ccccc1F.Cl |
| InChI | InChI=1S/C12H15FN2O3.ClH/c1-8(12(17)18)15(2)7-11(16)14-10-6-4-3-5-9(10)13;/h3-6,8H,7H2,1-2H3,(H,14,16)(H,17,18);1H |
| InChIKey | IHSLYLAKVCZDIZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.72 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |