C12H15ClN4O3S — CID 119912885
2-[[2-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride (PubChem CID 119912885) has the molecular formula C12H15ClN4O3S and a molecular weight of 330.80 g/mol. Its IUPAC name is 2-[[2-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[[2-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119912885 |
| Molecular Formula | C12H15ClN4O3S |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[[2-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CC(=O)Nc1cccc2c1N=S=N2.Cl |
| InChI | InChI=1S/C12H14N4O3S.ClH/c1-7(12(18)19)16(2)6-10(17)13-8-4-3-5-9-11(8)15-20-14-9;/h3-5,7H,6H2,1-2H3,(H,13,17)(H,18,19);1H |
| InChIKey | YFBMOVCDOSADOO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |