C13H19ClN2O5S — CID 119913063
2-[methyl-[2-(4-methylsulfonylanilino)-2-oxoethyl]amino]propanoic acid;hydrochloride (PubChem CID 119913063) has the molecular formula C13H19ClN2O5S and a molecular weight of 350.82 g/mol. Its IUPAC name is 2-[methyl-[2-(4-methylsulfonylanilino)-2-oxoethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 2-[methyl-[2-(4-methylsulfonylanilino)-2-oxoethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913063 |
| Molecular Formula | C13H19ClN2O5S |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[methyl-[2-(4-methylsulfonylanilino)-2-oxoethyl]amino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CC(=O)Nc1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C13H18N2O5S.ClH/c1-9(13(17)18)15(2)8-12(16)14-10-4-6-11(7-5-10)21(3,19)20;/h4-7,9H,8H2,1-3H3,(H,14,16)(H,17,18);1H |
| InChIKey | VBLBDHGOZNPWCO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |