C14H15Cl3N2O — CID 54816391
N,N-bis(prop-2-enyl)-2-(2,4,5-trichloroanilino)acetamide (PubChem CID 54816391) has the molecular formula C14H15Cl3N2O and a molecular weight of 333.65 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-2-(2,4,5-trichloroanilino)acetamide.
| Compound Name | N,N-bis(prop-2-enyl)-2-(2,4,5-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 54816391 |
| Molecular Formula | C14H15Cl3N2O |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N,N-bis(prop-2-enyl)-2-(2,4,5-trichloroanilino)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CNc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl3N2O/c1-3-5-19(6-4-2)14(20)9-18-13-8-11(16)10(15)7-12(13)17/h3-4,7-8,18H,1-2,5-6,9H2 |
| InChIKey | HQEGZJZLSYWWOX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|