C12H13Cl3N2O — CID 29053888
N-(cyclopropylmethyl)-2-(2,4,5-trichloroanilino)acetamide (PubChem CID 29053888) has the molecular formula C12H13Cl3N2O and a molecular weight of 307.61 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2,4,5-trichloroanilino)acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-(2,4,5-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 29053888 |
| Molecular Formula | C12H13Cl3N2O |
| Molecular Weight | 307.61 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2,4,5-trichloroanilino)acetamide |
| SMILES | O=C(CNc1cc(Cl)c(Cl)cc1Cl)NCC1CC1 |
| InChI | InChI=1S/C12H13Cl3N2O/c13-8-3-10(15)11(4-9(8)14)16-6-12(18)17-5-7-1-2-7/h3-4,7,16H,1-2,5-6H2,(H,17,18) |
| InChIKey | UNKSRFXWZWZQSQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|