C10H8Cl3NO2 — CID 103232496
2-[(2,4,5-trichloroanilino)methyl]prop-2-enoic acid (PubChem CID 103232496) has the molecular formula C10H8Cl3NO2 and a molecular weight of 280.54 g/mol. Its IUPAC name is 2-[(2,4,5-trichloroanilino)methyl]prop-2-enoic acid.
| Compound Name | 2-[(2,4,5-trichloroanilino)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103232496 |
| Molecular Formula | C10H8Cl3NO2 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | 2-[(2,4,5-trichloroanilino)methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1cc(Cl)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H8Cl3NO2/c1-5(10(15)16)4-14-9-3-7(12)6(11)2-8(9)13/h2-3,14H,1,4H2,(H,15,16) |
| InChIKey | NAGWWVKSNXKBJF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|