C11H9ClF3NO2 — CID 103250837
2-[[2-chloro-4-(trifluoromethyl)anilino]methyl]prop-2-enoic acid (PubChem CID 103250837) has the molecular formula C11H9ClF3NO2 and a molecular weight of 279.65 g/mol. Its IUPAC name is 2-[[2-chloro-4-(trifluoromethyl)anilino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[2-chloro-4-(trifluoromethyl)anilino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103250837 |
| Molecular Formula | C11H9ClF3NO2 |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-[[2-chloro-4-(trifluoromethyl)anilino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1ccc(C(F)(F)F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H9ClF3NO2/c1-6(10(17)18)5-16-9-3-2-7(4-8(9)12)11(13,14)15/h2-4,16H,1,5H2,(H,17,18) |
| InChIKey | KHSJLKTXGNIOEB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|