C13H13ClF3NO2 — CID 103231328
ethyl 2-[[2-chloro-5-(trifluoromethyl)anilino]methyl]prop-2-enoate (PubChem CID 103231328) has the molecular formula C13H13ClF3NO2 and a molecular weight of 307.70 g/mol. Its IUPAC name is ethyl 2-[[2-chloro-5-(trifluoromethyl)anilino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[2-chloro-5-(trifluoromethyl)anilino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103231328 |
| Molecular Formula | C13H13ClF3NO2 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | ethyl 2-[[2-chloro-5-(trifluoromethyl)anilino]methyl]prop-2-enoate |
| SMILES | C=C(CNc1cc(C(F)(F)F)ccc1Cl)C(=O)OCC |
| InChI | InChI=1S/C13H13ClF3NO2/c1-3-20-12(19)8(2)7-18-11-6-9(13(15,16)17)4-5-10(11)14/h4-6,18H,2-3,7H2,1H3 |
| InChIKey | IAUKFAINLPJVMQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|