C16H22ClF3N4O2 — CID 2319307
ethyl 2-[2-[2-chloro-5-(trifluoromethyl)phenyl]hydrazinyl]-2-[3-(dimethylamino)propylimino]acetate (PubChem CID 2319307) has the molecular formula C16H22ClF3N4O2 and a molecular weight of 394.83 g/mol. Its IUPAC name is ethyl 2-[2-[2-chloro-5-(trifluoromethyl)phenyl]hydrazinyl]-2-[3-(dimethylamino)propylimino]acetate.
| Compound Name | ethyl 2-[2-[2-chloro-5-(trifluoromethyl)phenyl]hydrazinyl]-2-[3-(dimethylamino)propylimino]acetate |
|---|---|
| PubChem CID | 2319307 |
| Molecular Formula | C16H22ClF3N4O2 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | ethyl 2-[2-[2-chloro-5-(trifluoromethyl)phenyl]hydrazinyl]-2-[3-(dimethylamino)propylimino]acetate |
| SMILES | CCOC(=O)/C(=N\CCCN(C)C)NNc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H22ClF3N4O2/c1-4-26-15(25)14(21-8-5-9-24(2)3)23-22-13-10-11(16(18,19)20)6-7-12(13)17/h6-7,10,22H,4-5,8-9H2,1-3H3,(H,21,23) |
| InChIKey | VNVZZNMLUUYADY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|