C10H11ClF3N3 — CID 62379619
1-[2-chloro-5-(trifluoromethyl)phenyl]-2-ethylguanidine (PubChem CID 62379619) has the molecular formula C10H11ClF3N3 and a molecular weight of 265.67 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-ethylguanidine.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-ethylguanidine |
|---|---|
| PubChem CID | 62379619 |
| Molecular Formula | C10H11ClF3N3 |
| Molecular Weight | 265.67 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-ethylguanidine |
| SMILES | CC/N=C(\N)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H11ClF3N3/c1-2-16-9(15)17-8-5-6(10(12,13)14)3-4-7(8)11/h3-5H,2H2,1H3,(H3,15,16,17) |
| InChIKey | CVBYPHCAIANVOC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.67 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|