C14H14Cl2F3N5 — CID 171152064
1-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4,6-dimethylpyrimidin-2-yl)guanidine;hydrochloride (PubChem CID 171152064) has the molecular formula C14H14Cl2F3N5 and a molecular weight of 380.20 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4,6-dimethylpyrimidin-2-yl)guanidine;hydrochloride.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4,6-dimethylpyrimidin-2-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 171152064 |
| Molecular Formula | C14H14Cl2F3N5 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4,6-dimethylpyrimidin-2-yl)guanidine;hydrochloride |
| SMILES | Cc1cc(C)nc(N=C(N)Nc2cc(C(F)(F)F)ccc2Cl)n1.Cl |
| InChI | InChI=1S/C14H13ClF3N5.ClH/c1-7-5-8(2)21-13(20-7)23-12(19)22-11-6-9(14(16,17)18)3-4-10(11)15;/h3-6H,1-2H3,(H3,19,20,21,22,23);1H |
| InChIKey | IWMKJPGVZOFPAR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|