C14H17N5 — CID 2864540
2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylphenyl)guanidine (PubChem CID 2864540) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylphenyl)guanidine.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 2864540 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(NC(N)=Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C14H17N5/c1-9-4-6-12(7-5-9)18-13(15)19-14-16-10(2)8-11(3)17-14/h4-8H,1-3H3,(H3,15,16,17,18,19) |
| InChIKey | YMOMRKDJDHSPHJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|