C18H24FN5O — CID 11551941
2-(4,6-dimethylpyrimidin-2-yl)-1-(3-fluoro-4-pentoxyphenyl)guanidine (PubChem CID 11551941) has the molecular formula C18H24FN5O and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-1-(3-fluoro-4-pentoxyphenyl)guanidine.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(3-fluoro-4-pentoxyphenyl)guanidine |
|---|---|
| PubChem CID | 11551941 |
| Molecular Formula | C18H24FN5O |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(3-fluoro-4-pentoxyphenyl)guanidine |
| SMILES | CCCCCOc1ccc(N/C(N)=N/c2nc(C)cc(C)n2)cc1F |
| InChI | InChI=1S/C18H24FN5O/c1-4-5-6-9-25-16-8-7-14(11-15(16)19)23-17(20)24-18-21-12(2)10-13(3)22-18/h7-8,10-11H,4-6,9H2,1-3H3,(H3,20,21,22,23,24) |
| InChIKey | WVEWBBGQYYQENS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|