C21H25N5O — CID 58638853
2-(4-methylquinazolin-2-yl)-1-(4-pentoxyphenyl)guanidine (PubChem CID 58638853) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 2-(4-methylquinazolin-2-yl)-1-(4-pentoxyphenyl)guanidine.
| Compound Name | 2-(4-methylquinazolin-2-yl)-1-(4-pentoxyphenyl)guanidine |
|---|---|
| PubChem CID | 58638853 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 2-(4-methylquinazolin-2-yl)-1-(4-pentoxyphenyl)guanidine |
| SMILES | CCCCCOc1ccc(N/C(N)=N/c2nc(C)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H25N5O/c1-3-4-7-14-27-17-12-10-16(11-13-17)24-20(22)26-21-23-15(2)18-8-5-6-9-19(18)25-21/h5-6,8-13H,3-4,7,14H2,1-2H3,(H3,22,23,24,25,26) |
| InChIKey | MJQXTFUDTWXSBT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|