C17H15N5O — CID 135436000
N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]benzamide (PubChem CID 135436000) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]benzamide.
| Compound Name | N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135436000 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]benzamide |
| SMILES | Cc1nc(N=C(N)NC(=O)c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C17H15N5O/c1-11-13-9-5-6-10-14(13)20-17(19-11)22-16(18)21-15(23)12-7-3-2-4-8-12/h2-10H,1H3,(H3,18,19,20,21,22,23) |
| InChIKey | WJSGMNIEESFJHZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|