C17H16N6O — CID 135444510
1-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]-3-phenylurea (PubChem CID 135444510) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]-3-phenylurea.
| Compound Name | 1-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]-3-phenylurea |
|---|---|
| PubChem CID | 135444510 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]-3-phenylurea |
| SMILES | Cc1nc(N=C(N)NC(=O)Nc2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C17H16N6O/c1-11-13-9-5-6-10-14(13)21-16(19-11)22-15(18)23-17(24)20-12-7-3-2-4-8-12/h2-10H,1H3,(H4,18,19,20,21,22,23,24) |
| InChIKey | ORHFLZOARRXFNU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|