C14H17N5O — CID 135506328
N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]butanamide (PubChem CID 135506328) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]butanamide.
| Compound Name | N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]butanamide |
|---|---|
| PubChem CID | 135506328 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]butanamide |
| SMILES | CCCC(=O)NC(N)=Nc1nc(C)c2ccccc2n1 |
| InChI | InChI=1S/C14H17N5O/c1-3-6-12(20)18-13(15)19-14-16-9(2)10-7-4-5-8-11(10)17-14/h4-5,7-8H,3,6H2,1-2H3,(H3,15,16,17,18,19,20) |
| InChIKey | XABBLHOIRAJPBJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|