C17H14ClN5O2 — CID 135407557
(4-chlorophenyl) N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]carbamate (PubChem CID 135407557) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is (4-chlorophenyl) N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]carbamate.
| Compound Name | (4-chlorophenyl) N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 135407557 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (4-chlorophenyl) N-[N'-(4-methylquinazolin-2-yl)carbamimidoyl]carbamate |
| SMILES | Cc1nc(N=C(N)NC(=O)Oc2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C17H14ClN5O2/c1-10-13-4-2-3-5-14(13)21-16(20-10)22-15(19)23-17(24)25-12-8-6-11(18)7-9-12/h2-9H,1H3,(H3,19,20,21,22,23,24) |
| InChIKey | POMQEOCSETXTBV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|