C19H19N5O — CID 135430047
N-[N'-(4,6,7-trimethylquinazolin-2-yl)carbamimidoyl]benzamide (PubChem CID 135430047) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is N-[N'-(4,6,7-trimethylquinazolin-2-yl)carbamimidoyl]benzamide.
| Compound Name | N-[N'-(4,6,7-trimethylquinazolin-2-yl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135430047 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-[N'-(4,6,7-trimethylquinazolin-2-yl)carbamimidoyl]benzamide |
| SMILES | Cc1cc2nc(N=C(N)NC(=O)c3ccccc3)nc(C)c2cc1C |
| InChI | InChI=1S/C19H19N5O/c1-11-9-15-13(3)21-19(22-16(15)10-12(11)2)24-18(20)23-17(25)14-7-5-4-6-8-14/h4-10H,1-3H3,(H3,20,21,22,23,24,25) |
| InChIKey | OYVBVMJMWOSKAH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|