C17H23N5 — CID 58638812
1-(3-tert-butylphenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine (PubChem CID 58638812) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 1-(3-tert-butylphenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine.
| Compound Name | 1-(3-tert-butylphenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 58638812 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 1-(3-tert-butylphenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
| SMILES | Cc1cc(C)nc(/N=C(/N)Nc2cccc(C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C17H23N5/c1-11-9-12(2)20-16(19-11)22-15(18)21-14-8-6-7-13(10-14)17(3,4)5/h6-10H,1-5H3,(H3,18,19,20,21,22) |
| InChIKey | OQBHUVXVUXTLGT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|