C20H21N7O2 — CID 75043234
2-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]-1-(3-nitrophenyl)guanidine (PubChem CID 75043234) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 2-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]-1-(3-nitrophenyl)guanidine.
| Compound Name | 2-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]-1-(3-nitrophenyl)guanidine |
|---|---|
| PubChem CID | 75043234 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]-1-(3-nitrophenyl)guanidine |
| SMILES | Cc1cc(NCCc2ccccc2)nc(N=C(N)Nc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C20H21N7O2/c1-14-12-18(22-11-10-15-6-3-2-4-7-15)25-20(23-14)26-19(21)24-16-8-5-9-17(13-16)27(28)29/h2-9,12-13H,10-11H2,1H3,(H4,21,22,23,24,25,26) |
| InChIKey | FKKWTXVTUZNUKH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|