C14H16N6O3 — CID 71931094
1-[2-[(6-methylpyridazin-3-yl)amino]ethyl]-3-(3-nitrophenyl)urea (PubChem CID 71931094) has the molecular formula C14H16N6O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-[2-[(6-methylpyridazin-3-yl)amino]ethyl]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[2-[(6-methylpyridazin-3-yl)amino]ethyl]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 71931094 |
| Molecular Formula | C14H16N6O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-[2-[(6-methylpyridazin-3-yl)amino]ethyl]-3-(3-nitrophenyl)urea |
| SMILES | Cc1ccc(NCCNC(=O)Nc2cccc([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C14H16N6O3/c1-10-5-6-13(19-18-10)15-7-8-16-14(21)17-11-3-2-4-12(9-11)20(22)23/h2-6,9H,7-8H2,1H3,(H,15,19)(H2,16,17,21) |
| InChIKey | STDAKJQXZOKSSO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|