C20H25N3O4 — CID 108882747
1-[3-(4-tert-butylphenoxy)propyl]-3-(3-nitrophenyl)urea (PubChem CID 108882747) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenoxy)propyl]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[3-(4-tert-butylphenoxy)propyl]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 108882747 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[3-(4-tert-butylphenoxy)propyl]-3-(3-nitrophenyl)urea |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-20(2,3)15-8-10-18(11-9-15)27-13-5-12-21-19(24)22-16-6-4-7-17(14-16)23(25)26/h4,6-11,14H,5,12-13H2,1-3H3,(H2,21,22,24) |
| InChIKey | NZWNWAPMPHXTIV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|