C20H26ClN3O2 — CID 108882764
1-(4-amino-3-chlorophenyl)-3-[3-(4-tert-butylphenoxy)propyl]urea (PubChem CID 108882764) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 1-(4-amino-3-chlorophenyl)-3-[3-(4-tert-butylphenoxy)propyl]urea.
| Compound Name | 1-(4-amino-3-chlorophenyl)-3-[3-(4-tert-butylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108882764 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-(4-amino-3-chlorophenyl)-3-[3-(4-tert-butylphenoxy)propyl]urea |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)Nc2ccc(N)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H26ClN3O2/c1-20(2,3)14-5-8-16(9-6-14)26-12-4-11-23-19(25)24-15-7-10-18(22)17(21)13-15/h5-10,13H,4,11-12,22H2,1-3H3,(H2,23,24,25) |
| InChIKey | SGOISWTZLWJTGL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|