C19H17N7O2 — CID 47053364
6-methyl-2-(3-nitrophenyl)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrimidin-4-amine (PubChem CID 47053364) has the molecular formula C19H17N7O2 and a molecular weight of 375.39 g/mol. Its IUPAC name is 6-methyl-2-(3-nitrophenyl)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-methyl-2-(3-nitrophenyl)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 47053364 |
| Molecular Formula | C19H17N7O2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 6-methyl-2-(3-nitrophenyl)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1cc(NCCc2nnc3ccccn23)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H17N7O2/c1-13-11-16(20-9-8-18-24-23-17-7-2-3-10-25(17)18)22-19(21-13)14-5-4-6-15(12-14)26(27)28/h2-7,10-12H,8-9H2,1H3,(H,20,21,22) |
| InChIKey | XUOBAOYQWOCWIB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|