C15H13N5O2S — CID 133278104
6-methyl-2-(3-nitrophenyl)-N-(1,3-thiazol-4-ylmethyl)pyrimidin-4-amine (PubChem CID 133278104) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is 6-methyl-2-(3-nitrophenyl)-N-(1,3-thiazol-4-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-methyl-2-(3-nitrophenyl)-N-(1,3-thiazol-4-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133278104 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 6-methyl-2-(3-nitrophenyl)-N-(1,3-thiazol-4-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCc2cscn2)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C15H13N5O2S/c1-10-5-14(16-7-12-8-23-9-17-12)19-15(18-10)11-3-2-4-13(6-11)20(21)22/h2-6,8-9H,7H2,1H3,(H,16,18,19) |
| InChIKey | GRHWBKPVZZYYNS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|