C19H21N5O2S — CID 133301310
N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-methyl-2-(3-nitrophenyl)pyrimidin-4-amine (PubChem CID 133301310) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-methyl-2-(3-nitrophenyl)pyrimidin-4-amine.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-methyl-2-(3-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133301310 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-methyl-2-(3-nitrophenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCc2csc(C(C)(C)C)n2)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H21N5O2S/c1-12-8-16(20-10-14-11-27-18(22-14)19(2,3)4)23-17(21-12)13-6-5-7-15(9-13)24(25)26/h5-9,11H,10H2,1-4H3,(H,20,21,23) |
| InChIKey | YNMGOYOPVDUYEW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|