C15H18N4O3 — CID 133434642
(2R)-2-[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 133434642) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-2-[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | (2R)-2-[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 133434642 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (2R)-2-[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CC[C@H](CO)Nc1cc(C)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C15H18N4O3/c1-3-12(9-20)17-14-7-10(2)16-15(18-14)11-5-4-6-13(8-11)19(21)22/h4-8,12,20H,3,9H2,1-2H3,(H,16,17,18)/t12-/m1/s1 |
| InChIKey | KLLZEFKHXZRCQQ-GFCCVEGCSA-N |
| XLogP | 2.54 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|