C14H14N4O3 — CID 133434507
2-[[(2S)-1-hydroxybutan-2-yl]amino]-6-nitroquinoline-4-carbonitrile (PubChem CID 133434507) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-[[(2S)-1-hydroxybutan-2-yl]amino]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[[(2S)-1-hydroxybutan-2-yl]amino]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133434507 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-[[(2S)-1-hydroxybutan-2-yl]amino]-6-nitroquinoline-4-carbonitrile |
| SMILES | CC[C@@H](CO)Nc1cc(C#N)c2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C14H14N4O3/c1-2-10(8-19)16-14-5-9(7-15)12-6-11(18(20)21)3-4-13(12)17-14/h3-6,10,19H,2,8H2,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | XXXUGCHJXYXAFH-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|