C16H13N5O2S — CID 133406244
2-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]-6-nitroquinoline-4-carbonitrile (PubChem CID 133406244) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133406244 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]-6-nitroquinoline-4-carbonitrile |
| SMILES | Cc1nc(CNc2cc(C#N)c3cc([N+](=O)[O-])ccc3n2)c(C)s1 |
| InChI | InChI=1S/C16H13N5O2S/c1-9-15(19-10(2)24-9)8-18-16-5-11(7-17)13-6-12(21(22)23)3-4-14(13)20-16/h3-6H,8H2,1-2H3,(H,18,20) |
| InChIKey | QHFPOPQZYIXEJE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|