C23H17N5O4 — CID 133318535
2-[[2-(4-methoxyphenoxy)-4-pyridinyl]methylamino]-6-nitroquinoline-4-carbonitrile (PubChem CID 133318535) has the molecular formula C23H17N5O4 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenoxy)-4-pyridinyl]methylamino]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[[2-(4-methoxyphenoxy)-4-pyridinyl]methylamino]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133318535 |
| Molecular Formula | C23H17N5O4 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[[2-(4-methoxyphenoxy)-4-pyridinyl]methylamino]-6-nitroquinoline-4-carbonitrile |
| SMILES | COc1ccc(Oc2cc(CNc3cc(C#N)c4cc([N+](=O)[O-])ccc4n3)ccn2)cc1 |
| InChI | InChI=1S/C23H17N5O4/c1-31-18-3-5-19(6-4-18)32-23-10-15(8-9-25-23)14-26-22-11-16(13-24)20-12-17(28(29)30)2-7-21(20)27-22/h2-12H,14H2,1H3,(H,26,27) |
| InChIKey | IRRGAULLVREBTN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|