C16H15N7O2 — CID 100710647
2-[2-[(1-methylpyrazol-3-yl)amino]ethylamino]-6-nitroquinoline-4-carbonitrile (PubChem CID 100710647) has the molecular formula C16H15N7O2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[2-[(1-methylpyrazol-3-yl)amino]ethylamino]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[2-[(1-methylpyrazol-3-yl)amino]ethylamino]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 100710647 |
| Molecular Formula | C16H15N7O2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[2-[(1-methylpyrazol-3-yl)amino]ethylamino]-6-nitroquinoline-4-carbonitrile |
| SMILES | Cn1ccc(NCCNc2cc(C#N)c3cc([N+](=O)[O-])ccc3n2)n1 |
| InChI | InChI=1S/C16H15N7O2/c1-22-7-4-15(21-22)18-5-6-19-16-8-11(10-17)13-9-12(23(24)25)2-3-14(13)20-16/h2-4,7-9H,5-6H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | SLRKBTCRIUOZMG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|