C16H16N4O4 — CID 133459187
2-[2-(2-methyl-1,3-dioxolan-2-yl)ethylamino]-6-nitroquinoline-4-carbonitrile (PubChem CID 133459187) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-[2-(2-methyl-1,3-dioxolan-2-yl)ethylamino]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[2-(2-methyl-1,3-dioxolan-2-yl)ethylamino]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133459187 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[2-(2-methyl-1,3-dioxolan-2-yl)ethylamino]-6-nitroquinoline-4-carbonitrile |
| SMILES | CC1(CCNc2cc(C#N)c3cc([N+](=O)[O-])ccc3n2)OCCO1 |
| InChI | InChI=1S/C16H16N4O4/c1-16(23-6-7-24-16)4-5-18-15-8-11(10-17)13-9-12(20(21)22)2-3-14(13)19-15/h2-3,8-9H,4-7H2,1H3,(H,18,19) |
| InChIKey | WUXULPDRVKOIAZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|