C15H15N5O3 — CID 133318104
3-[(4-cyano-6-nitroquinolin-2-yl)amino]-2,2-dimethylpropanamide (PubChem CID 133318104) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 3-[(4-cyano-6-nitroquinolin-2-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(4-cyano-6-nitroquinolin-2-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 133318104 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-[(4-cyano-6-nitroquinolin-2-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNc1cc(C#N)c2cc([N+](=O)[O-])ccc2n1)C(N)=O |
| InChI | InChI=1S/C15H15N5O3/c1-15(2,14(17)21)8-18-13-5-9(7-16)11-6-10(20(22)23)3-4-12(11)19-13/h3-6H,8H2,1-2H3,(H2,17,21)(H,18,19) |
| InChIKey | NSZRQFAJQFFUCC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|