C16H12N4O2S — CID 133310476
6-nitro-2-(2-thiophen-3-ylethylamino)quinoline-4-carbonitrile (PubChem CID 133310476) has the molecular formula C16H12N4O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 6-nitro-2-(2-thiophen-3-ylethylamino)quinoline-4-carbonitrile.
| Compound Name | 6-nitro-2-(2-thiophen-3-ylethylamino)quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133310476 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 6-nitro-2-(2-thiophen-3-ylethylamino)quinoline-4-carbonitrile |
| SMILES | N#Cc1cc(NCCc2ccsc2)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C16H12N4O2S/c17-9-12-7-16(18-5-3-11-4-6-23-10-11)19-15-2-1-13(20(21)22)8-14(12)15/h1-2,4,6-8,10H,3,5H2,(H,18,19) |
| InChIKey | HLAHBXRSXJOGGA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|