C22H21N5O2 — CID 133310462
2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]-6-nitroquinoline-4-carbonitrile (PubChem CID 133310462) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133310462 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]-6-nitroquinoline-4-carbonitrile |
| SMILES | N#Cc1cc(NCCCN2CCc3ccccc3C2)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C22H21N5O2/c23-14-18-12-22(25-21-7-6-19(27(28)29)13-20(18)21)24-9-3-10-26-11-8-16-4-1-2-5-17(16)15-26/h1-2,4-7,12-13H,3,8-11,15H2,(H,24,25) |
| InChIKey | PLDGHZWYDIAFIS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|