C21H23N3O — CID 133455973
4-acetyl-2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]benzonitrile (PubChem CID 133455973) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-acetyl-2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]benzonitrile.
| Compound Name | 4-acetyl-2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 133455973 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 4-acetyl-2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)c(NCCCN2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C21H23N3O/c1-16(25)18-7-8-19(14-22)21(13-18)23-10-4-11-24-12-9-17-5-2-3-6-20(17)15-24/h2-3,5-8,13,23H,4,9-12,15H2,1H3 |
| InChIKey | QUUOSTYAJBMWAA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|