C17H18N4O2 — CID 133311735
N-cyclohex-3-en-1-yl-6-methyl-2-(3-nitrophenyl)pyrimidin-4-amine (PubChem CID 133311735) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-6-methyl-2-(3-nitrophenyl)pyrimidin-4-amine.
| Compound Name | N-cyclohex-3-en-1-yl-6-methyl-2-(3-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133311735 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-cyclohex-3-en-1-yl-6-methyl-2-(3-nitrophenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NC2CC=CCC2)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C17H18N4O2/c1-12-10-16(19-14-7-3-2-4-8-14)20-17(18-12)13-6-5-9-15(11-13)21(22)23/h2-3,5-6,9-11,14H,4,7-8H2,1H3,(H,18,19,20) |
| InChIKey | LSGGQGPGQQQLCC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|