C19H25N5O4S — CID 133296105
6-methyl-N-[1-(2-methylsulfonylethyl)piperidin-4-yl]-2-(3-nitrophenyl)pyrimidin-4-amine (PubChem CID 133296105) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is 6-methyl-N-[1-(2-methylsulfonylethyl)piperidin-4-yl]-2-(3-nitrophenyl)pyrimidin-4-amine.
| Compound Name | 6-methyl-N-[1-(2-methylsulfonylethyl)piperidin-4-yl]-2-(3-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133296105 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 6-methyl-N-[1-(2-methylsulfonylethyl)piperidin-4-yl]-2-(3-nitrophenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NC2CCN(CCS(C)(=O)=O)CC2)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H25N5O4S/c1-14-12-18(21-16-6-8-23(9-7-16)10-11-29(2,27)28)22-19(20-14)15-4-3-5-17(13-15)24(25)26/h3-5,12-13,16H,6-11H2,1-2H3,(H,20,21,22) |
| InChIKey | BPKFOCHIMDZADZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|