C15H23N3O4S — CID 71865369
N-(2-methyl-4-nitrophenyl)-1-(2-methylsulfonylethyl)piperidin-4-amine (PubChem CID 71865369) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is N-(2-methyl-4-nitrophenyl)-1-(2-methylsulfonylethyl)piperidin-4-amine.
| Compound Name | N-(2-methyl-4-nitrophenyl)-1-(2-methylsulfonylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 71865369 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-(2-methyl-4-nitrophenyl)-1-(2-methylsulfonylethyl)piperidin-4-amine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC1CCN(CCS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H23N3O4S/c1-12-11-14(18(19)20)3-4-15(12)16-13-5-7-17(8-6-13)9-10-23(2,21)22/h3-4,11,13,16H,5-10H2,1-2H3 |
| InChIKey | CUICEKLZRWEQAN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|