C15H21N3O4S — CID 133348599
1-cyclopropylsulfonyl-N-(2-methyl-4-nitrophenyl)piperidin-4-amine (PubChem CID 133348599) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-N-(2-methyl-4-nitrophenyl)piperidin-4-amine.
| Compound Name | 1-cyclopropylsulfonyl-N-(2-methyl-4-nitrophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 133348599 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-cyclopropylsulfonyl-N-(2-methyl-4-nitrophenyl)piperidin-4-amine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC1CCN(S(=O)(=O)C2CC2)CC1 |
| InChI | InChI=1S/C15H21N3O4S/c1-11-10-13(18(19)20)2-5-15(11)16-12-6-8-17(9-7-12)23(21,22)14-3-4-14/h2,5,10,12,14,16H,3-4,6-9H2,1H3 |
| InChIKey | QPLZYWIBYVKOPS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|