C14H19F2N3O5S — CID 133468119
N-[2-(difluoromethoxy)-4-nitrophenyl]-1-ethylsulfonylpiperidin-4-amine (PubChem CID 133468119) has the molecular formula C14H19F2N3O5S and a molecular weight of 379.39 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-4-nitrophenyl]-1-ethylsulfonylpiperidin-4-amine.
| Compound Name | N-[2-(difluoromethoxy)-4-nitrophenyl]-1-ethylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 133468119 |
| Molecular Formula | C14H19F2N3O5S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[2-(difluoromethoxy)-4-nitrophenyl]-1-ethylsulfonylpiperidin-4-amine |
| SMILES | CCS(=O)(=O)N1CCC(Nc2ccc([N+](=O)[O-])cc2OC(F)F)CC1 |
| InChI | InChI=1S/C14H19F2N3O5S/c1-2-25(22,23)18-7-5-10(6-8-18)17-12-4-3-11(19(20)21)9-13(12)24-14(15)16/h3-4,9-10,14,17H,2,5-8H2,1H3 |
| InChIKey | QXWIUCJDVKJARZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|