C17H17F2N3O5 — CID 133468016
[4-[2-(difluoromethoxy)-4-nitroanilino]piperidin-1-yl]-(furan-2-yl)methanone (PubChem CID 133468016) has the molecular formula C17H17F2N3O5 and a molecular weight of 381.34 g/mol. Its IUPAC name is [4-[2-(difluoromethoxy)-4-nitroanilino]piperidin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[2-(difluoromethoxy)-4-nitroanilino]piperidin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 133468016 |
| Molecular Formula | C17H17F2N3O5 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [4-[2-(difluoromethoxy)-4-nitroanilino]piperidin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCC(Nc2ccc([N+](=O)[O-])cc2OC(F)F)CC1 |
| InChI | InChI=1S/C17H17F2N3O5/c18-17(19)27-15-10-12(22(24)25)3-4-13(15)20-11-5-7-21(8-6-11)16(23)14-2-1-9-26-14/h1-4,9-11,17,20H,5-8H2 |
| InChIKey | OHBRMYMXJGPTDL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|