C22H28IN5O4 — CID 110020749
N-cyclopentyl-4-(furan-2-carbonyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 110020749) has the molecular formula C22H28IN5O4 and a molecular weight of 553.40 g/mol. Its IUPAC name is N-cyclopentyl-4-(furan-2-carbonyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-cyclopentyl-4-(furan-2-carbonyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110020749 |
| Molecular Formula | C22H28IN5O4 |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | N-cyclopentyl-4-(furan-2-carbonyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.O=C(c1ccco1)N1CCN(/C(=N\Cc2ccc([N+](=O)[O-])cc2)NC2CCCC2)CC1 |
| InChI | InChI=1S/C22H27N5O4.HI/c28-21(20-6-3-15-31-20)25-11-13-26(14-12-25)22(24-18-4-1-2-5-18)23-16-17-7-9-19(10-8-17)27(29)30;/h3,6-10,15,18H,1-2,4-5,11-14,16H2,(H,23,24);1H |
| InChIKey | DOFLHNCCYPVBIE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|