C24H25N5O4 — CID 111168249
N'-benzyl-4-(furan-2-carbonyl)-N-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111168249) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is N'-benzyl-4-(furan-2-carbonyl)-N-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-benzyl-4-(furan-2-carbonyl)-N-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111168249 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N'-benzyl-4-(furan-2-carbonyl)-N-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide |
| SMILES | O=C(c1ccco1)N1CCN(/C(=N/Cc2ccccc2)NCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C24H25N5O4/c30-23(22-7-4-16-33-22)27-12-14-28(15-13-27)24(25-17-19-5-2-1-3-6-19)26-18-20-8-10-21(11-9-20)29(31)32/h1-11,16H,12-15,17-18H2,(H,25,26) |
| InChIKey | CMMIKDIRJSDROL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|