C23H26IN7O2 — CID 111206149
N'-benzyl-N-[(4-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111206149) has the molecular formula C23H26IN7O2 and a molecular weight of 559.41 g/mol. Its IUPAC name is N'-benzyl-N-[(4-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-benzyl-N-[(4-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111206149 |
| Molecular Formula | C23H26IN7O2 |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | N'-benzyl-N-[(4-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | I.O=[N+]([O-])c1ccc(CN/C(=N\Cc2ccccc2)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C23H25N7O2.HI/c31-30(32)21-9-7-20(8-10-21)18-27-23(26-17-19-5-2-1-3-6-19)29-15-13-28(14-16-29)22-24-11-4-12-25-22;/h1-12H,13-18H2,(H,26,27);1H |
| InChIKey | RRYFEUBWVLZFTB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|