C17H22IN7O2 — CID 111206927
N'-methyl-N-[(2-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111206927) has the molecular formula C17H22IN7O2 and a molecular weight of 483.31 g/mol. Its IUPAC name is N'-methyl-N-[(2-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(2-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111206927 |
| Molecular Formula | C17H22IN7O2 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | N'-methyl-N-[(2-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1[N+](=O)[O-])N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C17H21N7O2.HI/c1-18-16(21-13-14-5-2-3-6-15(14)24(25)26)22-9-11-23(12-10-22)17-19-7-4-8-20-17;/h2-8H,9-13H2,1H3,(H,18,21);1H |
| InChIKey | BSKKLHVOTXFOHD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|